| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,1,2,2-Tetrahydroperfluoro dodecanol Basic information |
| Product Name: | 1,1,2,2-Tetrahydroperfluoro dodecanol | | Synonyms: | 1H,1H,2H,2H-PERFLUORO-1-DODECANOL;1H,1H,2H,2H-PERFLUORODODECAN-1-OL;1H,1H,2H,2H-PERFLUORODODECANOL;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro-1-dodecano;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro-1-Dodecanol;1-Dodecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro-;1H,1H,2H,2H-Perfluorododecan-1-ol 97%;1H,1H,2H,2H-Perfluorododecan-1-ol97% | | CAS: | 865-86-1 | | MF: | C12H5F21O | | MW: | 564.13 | | EINECS: | 212-748-7 | | Product Categories: | Organics | | Mol File: | 865-86-1.mol |  |
| | 1,1,2,2-Tetrahydroperfluoro dodecanol Chemical Properties |
| Melting point | 95 °C | | Boiling point | 145 °C | | density | 1.664±0.06 g/cm3(Predicted) | | refractive index | 1.294 @ 25 °C | | Fp | 145°C/10mm | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly, Heated, Sonicated), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 14.28±0.10(Predicted) | | color | White to Off-White | | Water Solubility | Insoluble in water. | | BRN | 2029867 | | Henry's Law Constant | 1.4×10-4 mol/(m3Pa) at 25℃, Abusallout et al. (2022) | | Major Application | PFAS testing
clinical testing
coatings
environmental
food and beverages | | InChIKey | FLXYIZWPNQYPIT-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO | | CAS DataBase Reference | 865-86-1(CAS DataBase Reference) | | EPA Substance Registry System | 1-Dodecanol, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluoro- (865-86-1) |
| Hazard Codes | F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | WGK 3 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HS Code | 29055900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Lact.
Repr. 1B
STOT RE 1 |
| Provider | Language |
|
ALFA
| English |
| | 1,1,2,2-Tetrahydroperfluoro dodecanol Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 1H,1H,2H,2H-Perfluorododecan-1-ol is a fluorotelomer alcohol (FTOH) often detected in indoor dust. |
| | 1,1,2,2-Tetrahydroperfluoro dodecanol Preparation Products And Raw materials |
|