|
|
| | GLUTARIC DIHYDRAZIDE Basic information |
| Product Name: | GLUTARIC DIHYDRAZIDE | | Synonyms: | AKOS BBS-00001038;GLUTARIC DIHYDRAZIDE;pentanedihydrazide;pentanedioic acid, dihydrazide;glutarohydrazide;Pentanedioic acid, 1,5-dihydrazide;pentanedihydrazine;Glutaric acid dihydrazide | | CAS: | 1508-67-4 | | MF: | C5H12N4O2 | | MW: | 160.17 | | EINECS: | | | Product Categories: | | | Mol File: | 1508-67-4.mol |  |
| | GLUTARIC DIHYDRAZIDE Chemical Properties |
| Melting point | 175-176 °C(Solv: ethanol (64-17-5)) | | Boiling point | 529.1±33.0 °C(Predicted) | | density | 1.229±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 12.83±0.35(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C5H12N4O2/c6-8-4(10)2-1-3-5(11)9-7/h1-3,6-7H2,(H,8,10)(H,9,11) | | InChIKey | LGYJSPMYALQHBL-UHFFFAOYSA-N | | SMILES | C(=O)(NN)CCCC(=O)NN |
| | GLUTARIC DIHYDRAZIDE Usage And Synthesis |
| | GLUTARIC DIHYDRAZIDE Preparation Products And Raw materials |
|