| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Oleoyl lysophosphatidic acid sodium salt Basic information |
| Product Name: | 1-Oleoyl lysophosphatidic acid sodium salt | | Synonyms: | o-LPA;18:1 Ly;LPA sodium salt;L-ALPHA-LYSOPHOSPHATIDIC ACID, OLEOYL SODIUM SALT;LYSOPHOSPHATIDIC ACID, SODIUM SALT;3-SN-LYSOPHOSPHATIDIC ACID, 1-OLEOYL SODIUM SALT;1-O-9Z-OCTADECENOYL-SN-GLYCERYL-3-PHOSPHORIC ACID, SODIUM SALT;1-OLEOYL-2-HYDROXY-SN-GLYCEROL-3-PHOSPHATE, SODIUM SALT | | CAS: | 22556-62-3 | | MF: | C21H42NaO7P | | MW: | 460.52 | | EINECS: | | | Product Categories: | | | Mol File: | 22556-62-3.mol |  |
| | 1-Oleoyl lysophosphatidic acid sodium salt Chemical Properties |
| storage temp. | -20°C | | form | solid | | color | white | | Water Solubility | Soluble in water up to 5mg/ml with sonication | | Sensitive | Light & Air Sensitive & Hygroscopic | | InChI | 1S/C21H41O7P.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26;;/h9-10,20,22H,2-8,11-19H2,1H3,(H2,24,25,26);;/b10-9+;; | | InChIKey | CHJOEWDRTPWOCY-TTWKNDKESA-N | | SMILES | O[C@](COP([O-])(O)=O)([H])COC(CCCCCCC/C=C\CCCCCCCC)=O.[Na+] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Oleoyl lysophosphatidic acid sodium salt Usage And Synthesis |
| Uses | Oleoyl-L-α-lysophosphatidic Acid reduces the organ injury caused by endotoxemia in the rat.It may be useful in the treatment of shock of various etiologies. | | General Description | Lysophosphatidic acid (LPA) is an essential metabolite for membrane biosynthesis. LPA interacts with the G protein-coupled receptors (GPCRs), called the LPA receptor and mediates signaling. Oleoyl-L-α-lysophosphatidic acid activates the receptor LPA4. In keratinocytes, oleoyl-L-α-lysophosphatidic acid promotes growth to some extent. | | Biochem/physiol Actions | Endogenous agonist for LPA1 and LPA2 receptors. LPA does not induce angiogenesis, but has effects on endothelial cell physiology that are similar to those of sphingosine 1-phosphate. Induces cell migration of cancer and non-cancer cells. |
| | 1-Oleoyl lysophosphatidic acid sodium salt Preparation Products And Raw materials |
|