| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 19370895928 |
| Email: |
qzhang@aikonchem.com |
| Products Intro: |
Product Name:Acetic acid,2-(3-formyl-4-nitrophenoxy)-
CAS:105728-06-1
Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Jinan ponder chemical co. LTD
|
| Tel: |
0531-0000 |
| Email: |
thinklifescience@163.com |
| Products Intro: |
Product Name:105728-06-1
CAS:105728-06-1
Purity:99% HPLC Package:1KG;500G;100G；50G;1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(3-Formyl-4-nitrophenoxy)acetic acid
CAS:105728-06-1
|
|
| | (3-FORMYL-4-NITROPHENOXY)ACETIC ACID Basic information |
| | (3-FORMYL-4-NITROPHENOXY)ACETIC ACID Chemical Properties |
| InChI | 1S/C9H7NO6/c11-4-6-3-7(16-5-9(12)13)1-2-8(6)10(14)15/h1-4H,5H2,(H,12,13) | | InChIKey | LNLRSVVPVPSANB-UHFFFAOYSA-N | | SMILES | [N+](=O)([O-])c1c(cc(cc1)OCC(=O)O)C=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | (3-FORMYL-4-NITROPHENOXY)ACETIC ACID Usage And Synthesis |
| | (3-FORMYL-4-NITROPHENOXY)ACETIC ACID Preparation Products And Raw materials |
|