| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | CBZ-β-HoGlu(OtBu)-OH Basic information |
| Product Name: | CBZ-β-HoGlu(OtBu)-OH | | Synonyms: | CBZ-β-HoGlu(OtBu)-OH;N-Cbz-(S)-3-amino-6-(tert-butoxy)-6-oxohexanoic acid;Hexanedioic acid, 3-[[(phenylmethoxy)carbonyl]amino]-, 6-(1,1-dimethylethyl) ester, (3S)-;Z-L-beta-homo-Glu(OtBu)-OH;(S)-3-(((Benzyloxy)carbonyl)amino)-6-(tert-butoxy)-6-oxohexanoic acid - [B91855] | | CAS: | 2135655-76-2 | | MF: | C18H25NO6 | | MW: | 351.39 | | EINECS: | | | Product Categories: | | | Mol File: | 2135655-76-2.mol |  |
| | CBZ-β-HoGlu(OtBu)-OH Chemical Properties |
| Boiling point | 531.9±50.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 4.35±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | -17.03°(C=0.4769 g/100mI, CHCL3 , 20°C, 589nm) | | InChI | InChI=1S/C18H25NO6/c1-18(2,3)25-16(22)10-9-14(11-15(20)21)19-17(23)24-12-13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,19,23)(H,20,21)/t14-/m0/s1 | | InChIKey | WLEKMWHPQDAGJJ-AWEZNQCLSA-N | | SMILES | C(O)(=O)C[C@@H](NC(OCC1=CC=CC=C1)=O)CCC(OC(C)(C)C)=O |
| | CBZ-β-HoGlu(OtBu)-OH Usage And Synthesis |
| | CBZ-β-HoGlu(OtBu)-OH Preparation Products And Raw materials |
|