| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
GSK199 (hydrochloride) manufacturers
- GSK199
-
- $59.00
-
2026-07-15
- CAS:1549811-53-1
- Purity: 99.44%
- Supply Ability: 10g
|
| | GSK199 (hydrochloride) Basic information |
| Product Name: | GSK199 (hydrochloride) | | Synonyms: | GSK199 (hydrochloride);GSK 199;GSK-199 hydrochloride
(GSK199);GSK-199 Hydrochloric Acid Salt;GSK199 (R)-(3-Aminopiperidin-1-yl)(2-(1-ethyl-1H-pyrrolo[2,3-b]pyridin-2-yl)-7-methoxy-1-methyl-1H-benzo[d]imidazol-5-yl)methanone hydrochloride;GSK 199,GSK-199,GSK199,Inhibitor,Peptidylarginine Deiminase,Protein Arginine Deiminase,inhibit;GSK199, 10 mM in DMSO;(R)-(3-Aminopiperidin-1-yl)(2-(1-ethyl-1H-pyrrolo[2,3-b]pyridin-2-yl)-7-methoxy-1-methyl-1H-benzo[d]imidazol-5-yl)methanone hydrochloride | | CAS: | 1549811-53-1 | | MF: | C24H29ClN6O2 | | MW: | 468.99 | | EINECS: | | | Product Categories: | | | Mol File: | 1549811-53-1.mol |  |
| | GSK199 (hydrochloride) Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMF:30.0(Max Conc. mg/mL);63.97(Max Conc. mM)
DMSO:30.0(Max Conc. mg/mL);63.97(Max Conc. mM)
Ethanol:30.0(Max Conc. mg/mL);63.97(Max Conc. mM)
PBS (pH 7.2):10.0(Max Conc. mg/mL);21.32(Max Conc. mM) | | form | A crystalline solid | | color | Light yellow to yellow | | InChIKey | KRGMIOKDGHBYQE-VOPAOICTNA-N | | SMILES | C(N1C2=NC=CC=C2C=C1C1N(C2=C(C=C(C(N3CCC[C@@H](N)C3)=O)C=C2N=1)OC)C)C.Cl |&1:21,r| |
| | GSK199 (hydrochloride) Usage And Synthesis |
| Uses | GSK-199 is a novel selective PAD4 inhibitor . |
| | GSK199 (hydrochloride) Preparation Products And Raw materials |
|