N6-CYCLOHEXYLADENOSINE manufacturers
|
| | N6-CYCLOHEXYLADENOSINE Basic information |
| Product Name: | N6-CYCLOHEXYLADENOSINE | | Synonyms: | CHA;N6-CYCLOHEXYLADENOSINE;N6-CYCLOHEXYLADENOSINE (CHA) SELECTIVE A 1 ADENOSIN;N(sup 6)-cyclohexyladenosine;Cyclohexyladenosine;N-Cyclohexyladenosine;Adenosine, N-cyclohexyl-;N6-Cyclohexyladenosine,CHA | | CAS: | 36396-99-3 | | MF: | C16H23N5O4 | | MW: | 349.38 | | EINECS: | | | Product Categories: | | | Mol File: | 36396-99-3.mol |  |
| | N6-CYCLOHEXYLADENOSINE Chemical Properties |
| Melting point | 182 - 184°C | | Boiling point | 675.2±65.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.12±0.70(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C16H23N5O4/c22-6-10-12(23)13(24)16(25-10)21-8-19-11-14(17-7-18-15(11)21)20-9-4-2-1-3-5-9/h7-10,12-13,16,22-24H,1-6H2,(H,17,18,20)/t10-,12-,13-,16-/m1/s1 | | InChIKey | SZBULDQSDUXAPJ-XNIJJKJLSA-N | | SMILES | OC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(NC4CCCCC4)ncnc23 |
| WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| | N6-CYCLOHEXYLADENOSINE Usage And Synthesis |
| Description | N6-Cyclohexyladenosine is an adenosine receptor agonist. It selectively binds to adenosine A1 receptors in rat cortical membranes (IC50 = 2.3 nM) over A2 receptors in rat striatal membranes (IC50 = 870 nM). N6-Cyclohexyladenosine decreases heart rate and increases coronary flow in a perfused working rat heart model ex vivo (EC25s = 5 and 860 nM, respectively). In vivo, it decreases heart rate and blood pressure in normotensive rats (EC25s = 2.4 and 4.2 μg/kg, respectively). N6-Cyclohexyladenosine (100 μM) induces sleep in rats when administered via basal forebrain infusion. N6-Cyclohexyladenosine also decreases locomotor activity in mice (ED50 = 60 μg/kg, i.p.). | | Uses | N6-Cyclohexyladenosine is a derivative of Adenosine (A280400), and is used testing adenosine A1 and A2A receptor activation for pharmaceuticals such as antidepressants. N6-Cyclohexyladenosine also is used as a JAK2 inhibitor, blocking STAT3 signalling in human cancer cells. | | Biochem/physiol Actions | Selective A1 adenosine receptor agonist. | | storage | Store at -20°C | | References | [1] A J HUTCHISON. CGS 21680C, an A2 selective adenosine receptor agonist with preferential hypotensive activity.[J]. Journal of Pharmacology and Experimental Therapeutics, 1989, 251 1: 47-55.
[2] CARLOS BLANCO-CENTURION. Adenosine and sleep homeostasis in the Basal forebrain.[J]. Journal of Neuroscience, 2006, 26 31: 8092-8100. DOI: 10.1523/jneurosci.2181-06.2006
[3] OLGA NIKODIJEVI Kenneth A J John W Daly. Characterization of the locomotor depression produced by an A2-selective adenosine agonist[J]. FEBS Letters, 1990, 261 1: Pages 67-70. DOI: 10.1016/0014-5793(90)80638-y |
| | N6-CYCLOHEXYLADENOSINE Preparation Products And Raw materials |
|