| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Phosphoric acid-17O4 Basic information |
| | Phosphoric acid-17O4 Chemical Properties |
| InChI | 1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)/i1+1,2+1,3+1,4+1 | | InChIKey | NBIIXXVUZAFLBC-JCDJMFQYSA-N | | SMILES | [17OH]P([17OH])([17OH])=[17O] |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-45 | | RIDADR | UN 1805 8/PG 3 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
| | Phosphoric acid-17O4 Usage And Synthesis |
| | Phosphoric acid-17O4 Preparation Products And Raw materials |
|