|
|
| | CHEMBRDG-BB 6745535 Basic information |
| Product Name: | CHEMBRDG-BB 6745535 | | Synonyms: | 5-BROMO-7-METHOXY-1-BENZOFURAN-2-CARBOXYLIC ACID;5-bromo-7-methoxy-1-benzofuran-2-carboxylic acid(SALTDATA: FREE);CHEMBRDG-BB 6745535;5-Bromo-7-methoxybenzofuran-2-carboxylic acid;2-Benzofurancarboxylic acid, 5-bromo-7-methoxy- | | CAS: | 20037-37-0 | | MF: | C10H7BrO4 | | MW: | 271.06 | | EINECS: | | | Product Categories: | | | Mol File: | 20037-37-0.mol |  |
| | CHEMBRDG-BB 6745535 Chemical Properties |
| Melting point | 250 °C | | Boiling point | 397.4±37.0 °C(Predicted) | | density | 1.704±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | solid | | pka | 2.86±0.30(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C10H7BrO4/c1-14-7-4-6(11)2-5-3-8(10(12)13)15-9(5)7/h2-4H,1H3,(H,12,13) | | InChIKey | OEICZFFUNDGUEF-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC2=C(C(OC)=CC(Br)=C2)O1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-53 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | CHEMBRDG-BB 6745535 Usage And Synthesis |
| | CHEMBRDG-BB 6745535 Preparation Products And Raw materials |
|