|
|
| | Potassium perfluoro(2-ethoxyethane)sulfonate Basic information |
| Product Name: | Potassium perfluoro(2-ethoxyethane)sulfonate | | Synonyms: | POTASSIUM PERFLUORO(2-ETHOXYETHANE)SULPHONATE;Potassium perfluoro(2-ethoxy)sulfonate;Potassium 1,1,2,2-tetrafluoro-2-(perfluoroethoxy)ethane-1-sulfonate;Potassium perfluoro(2-ethoxy)sulfonate in Methanol;Ethanesulfonic acid, 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)-, potassium salt (1:1);Potassium perfluoro(2-ethoxyethane)sulfonate 1.2 mL 50.0 μg/mL;Potassium perfluoro(2-ethoxyethane)sulfonate | | CAS: | 117205-07-9 | | MF: | C4F9KO4S | | MW: | 354.19 | | EINECS: | | | Product Categories: | | | Mol File: | 117205-07-9.mol |  |
| | Potassium perfluoro(2-ethoxyethane)sulfonate Chemical Properties |
| form | Solid | | InChI | InChI=1S/C4HF9O4S.K/c5-1(6,7)2(8,9)17-3(10,11)4(12,13)18(14,15)16;/h(H,14,15,16);/q;+1/p-1 | | InChIKey | LRLOPVLXVNLHIC-UHFFFAOYSA-M | | SMILES | C(F)(F)(OC(F)(F)C(F)(F)F)C(F)(F)S([O-])(=O)=O.[K+] | | EPA Substance Registry System | Potassium 1,1,2,2-tetrafluoro-2-(pentafluoroethoxy)ethane-1-sulfonate (117205-07-9) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2904990090 |
| | Potassium perfluoro(2-ethoxyethane)sulfonate Usage And Synthesis |
| | Potassium perfluoro(2-ethoxyethane)sulfonate Preparation Products And Raw materials |
|