| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2-Azidoethyl β-lactopyranoside Basic information |
| Product Name: | 2-Azidoethyl β-lactopyranoside | | Synonyms: | 2-Azidoethyl beta-lactopyranoside;2-Azidoethyl beta-lactopyranoside >=95%;2-Azidoethyl β-D-lactoside;2-Azidoethyl β-lactopyranoside;β-D-Lac-Ethyl-Azide;RMA-496;b-D-Glucopyranoside, 2-azidoethyl 4-O-b-D-galactopyranosyl- | | CAS: | 230286-11-0 | | MF: | C14H25N3O11 | | MW: | 411.36 | | EINECS: | | | Product Categories: | | | Mol File: | 230286-11-0.mol |  |
| | 2-Azidoethyl β-lactopyranoside Chemical Properties |
| storage temp. | -20°C | | form | solid | | biological source | synthetic (organic) | | InChI | 1S/C14H25N3O11/c15-17-16-1-2-25-13-11(24)9(22)12(6(4-19)27-13)28-14-10(23)8(21)7(20)5(3-18)26-14/h5-14,18-24H,1-4H2/t5,6,7,8-,9+,10,11,12+,13+,14-/m0/s1 | | InChIKey | RJQOAPBBNHAZBL-KZWDPACUSA-N | | SMILES | O[C@@H]1[C@H](O)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](OCCN=[N+]=[N-])O[C@@H]2CO)O[C@@H]1CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Azidoethyl β-lactopyranoside Usage And Synthesis |
| Uses | beta-Lac-EO-N3 is a click chemistry reagent. Click chemistry has great potential for use in binding between nucleic acids, lipids, proteins, and other molecules, and has been used in many research fields because of its beneficial characteristics, including high yield, high specificity, and simplicity[1]. It contains an azide group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. It can also undergo ring strain-promoted alkyne-azide cycloaddition (SPAAC) with molecules containing DBCO or BCN groups. | | Biochem/physiol Actions | 2-Azidoethyl β-lactopyranoside is an alkylated glycoside. Alkylated glycosides are used as ligands for Click Chemistry. They may also be important as carbohydrate carriers in glycotherapeutic applications, drug carriers for site-specific delivery, drug enhancers for decreasing toxicity, and solubility and protein enhancers. | | References | [1] Jiang X, et al. Recent applications of click chemistry in drug discovery. Expert Opin Drug Discov. 2019 Aug;14(8):779-789. DOI:10.1080/17460441.2019.1614910 |
| | 2-Azidoethyl β-lactopyranoside Preparation Products And Raw materials |
|