| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
|
| | Bis(4-methylphenyl)chlorophosphine Basic information |
| Product Name: | Bis(4-methylphenyl)chlorophosphine | | Synonyms: | DI(4-TOLYL)CHLOROPHOSPHINE;BIS(4-METHYLPHENYL)PHOSPHINOUS CHLORIDE;Bis(p-tolyl)chlorophosphine,;Bis(p-tolyl)chlorophosphine,98%;Phosphinous chloride,P,P-bis(3-methylphenyl)-;Chlorodi-m-tolylphosphane;Bis(4-methylphenyl)chlorophosphine | | CAS: | 13685-23-9 | | MF: | C14H14ClP | | MW: | 248.69 | | EINECS: | | | Product Categories: | | | Mol File: | 13685-23-9.mol |  |
| | Bis(4-methylphenyl)chlorophosphine Chemical Properties |
| Boiling point | 180-184°C/10mm | | density | 1.159 | | refractive index | n20/D 1.501 | | Fp | 180-184°C/10mm | | Sensitive | Moisture Sensitive |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN1760 | | HazardClass | 8 | | PackingGroup | II |
| | Bis(4-methylphenyl)chlorophosphine Usage And Synthesis |
| | Bis(4-methylphenyl)chlorophosphine Preparation Products And Raw materials |
|