| Company Name: |
LOBERAN PHARMA
|
| Tel: |
+91-8368351617 +91-8006595568 |
| Email: |
md@loberanpharma.com |
| Products Intro: |
Product Name:Methyl 2-(2-(chloromethyl)phenyl)-3-methoxyacrylate
CAS:117428-95-2
Purity:> 99 Package:100 Kg,500 Kg,1.0MT Remarks:Solid
|
| Company Name: |
Shanghai Jiegu Biotechnology Co., Ltd.
|
| Tel: |
021-51698675 |
| Email: |
sales@jiejiegroup.com |
| Products Intro: |
Product Name:IN-QCC64 (5B intermediate)
CAS:117428-95-2
Purity:97% HPLC Package:100KG;1KG
|
|
| | IN-QCC64 (5B intermediate) Basic information |
| Product Name: | IN-QCC64 (5B intermediate) | | Synonyms: | IN-QCC64 (5B intermediate);Benzeneacetic acid, 2-(chloromethyl)-α-(methoxymethylene)-, methyl ester;methyl 2-(2-chloromethylphenyl)-3-methoxyacrylate;Methyl 2 - (2-choromethylphenyl) -3 methoxyacrylate;Methyl 2- (2-choromethylpheny1)-3methoxyacrylate | | CAS: | 117428-95-2 | | MF: | C12H13ClO3 | | MW: | 240.68 | | EINECS: | 473-070-7 | | Product Categories: | | | Mol File: | 117428-95-2.mol |  |
| | IN-QCC64 (5B intermediate) Chemical Properties |
| Boiling point | 324.85℃ | | density | 1.31 at 20.5℃ | | vapor pressure | 0.004Pa at 25℃ | | form | Solid:particulate/powder | | InChI | InChI=1S/C12H13ClO3/c1-15-8-11(12(14)16-2)10-6-4-3-5-9(10)7-13/h3-6,8H,7H2,1-2H3 | | InChIKey | QHBMFLGCOYKWJH-UHFFFAOYSA-N | | SMILES | C1(C(=COC)C(OC)=O)=CC=CC=C1CCl | | LogP | 1.67 at 30℃ and pH6.9 | | Surface tension | 68.6mN/m at 51mg/L and 22℃ |
| | IN-QCC64 (5B intermediate) Usage And Synthesis |
| | IN-QCC64 (5B intermediate) Preparation Products And Raw materials |
|