|
|
| | 3-Dimethoxymethyl-5-trimethylsilanylethynyl-pyridine Basic information |
| | 3-Dimethoxymethyl-5-trimethylsilanylethynyl-pyridine Chemical Properties |
| Boiling point | 294.5±40.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | form | solid | | pka | 4.47±0.24(Predicted) | | InChI | 1S/C13H19NO2Si/c1-15-13(16-2)12-8-11(9-14-10-12)6-7-17(3,4)5/h8-10,13H,1-5H3 | | InChIKey | OZASIYDGVNBWMZ-UHFFFAOYSA-N | | SMILES | COC(OC)c1cncc(c1)C#C[Si](C)(C)C |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Dimethoxymethyl-5-trimethylsilanylethynyl-pyridine Usage And Synthesis |
| | 3-Dimethoxymethyl-5-trimethylsilanylethynyl-pyridine Preparation Products And Raw materials |
|