- BORON SILICIDE
-
- $2.00
-
2019-07-06
- CAS:12008-29-6
- Min. Order: 1KG
- Purity: 99%
|
| | BORON SILICIDE Basic information |
| Product Name: | BORON SILICIDE | | Synonyms: | BORON SILICIDE;SILICON HEXABORIDE;SILICON BORIDE;boronsilicide(b6si);hexaboron silicide;SILICON HEXABORIDE -325 MESH;Siliconboride98%powder;Boron silicide, 98% trace metals basis | | CAS: | 12008-29-6 | | MF: | B6Si | | MW: | 92.95 | | EINECS: | 234-535-8 | | Product Categories: | | | Mol File: | 12008-29-6.mol |  |
| | BORON SILICIDE Chemical Properties |
| Melting point | 2540℃ [KIR78] | | density | 2.470 | | form | Powder | | Specific Gravity | 2.430 | | color | black crystals, crystalline | | Resistivity | 200,000 (ρ/μΩ.cm) | | Water Solubility | Insoluble in water. | | Thermal Conductivity | 9.832 W/(m·K) | | Crystal Structure | Trigonal | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/B6Si/c1-2-5-3(1)7(5)4(1)6(2)7 | | InChIKey | ZRBFEDMQRDRUDG-UHFFFAOYSA-N | | SMILES | [Si]123B4B5B(B14)B2B35 | | CAS DataBase Reference | 12008-29-6(CAS DataBase Reference) | | EPA Substance Registry System | Boron silicide (B6Si) (12008-29-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed |
| | BORON SILICIDE Usage And Synthesis |
| Chemical Properties | black crystal(s); -200 mesh; also material with composition B4Si [12007-81-7] and 98% purity [CRC10] [CER91] [ALF93] | | Uses | Boron silicide is used in chemical research, pharmaceuticals and as an intermediate. |
| | BORON SILICIDE Preparation Products And Raw materials |
|