| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,6-Dichloro-3-fluorophenacyl bromide Basic information |
| | 2,6-Dichloro-3-fluorophenacyl bromide Chemical Properties |
| Melting point | 42-44 | | Fp | 110 °C | | storage temp. | 2-8°C | | form | solid | | Sensitive | Light Sensitive/Lachrymatory | | InChI | 1S/C8H4BrCl2FO/c9-3-6(13)7-4(10)1-2-5(12)8(7)11/h1-2H,3H2 | | InChIKey | QFVUFUXFUVITSO-UHFFFAOYSA-N | | SMILES | Fc1ccc(Cl)c(c1Cl)C(=O)CBr |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive/Lachrymatory/Light Sensitive | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2,6-Dichloro-3-fluorophenacyl bromide Usage And Synthesis |
| Uses | 2-Bromo-2,6-dichloro-3-fluoroacetophenone is used as a reactant in the synthesis of aminoarylthiazole derivatives as correctors of the chloride transport defect in cystic fibrosis. |
| | 2,6-Dichloro-3-fluorophenacyl bromide Preparation Products And Raw materials |
|