| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (4-Fluorophenyl)diphenylsulfonium triflate Basic information |
| Product Name: | (4-Fluorophenyl)diphenylsulfonium triflate | | Synonyms: | (4-fluorophenyl)-diphenylsulfanium,trifluoromethanesulfonate;DIPHENYL(4-FLUOROPHENYL)SULFONIUM TRIFLATE;DIPHENYL(4-FLUOROPHENYL)SULPHONIUM TRIFLATE;4-FLUOROPHENYL DIPHENYLSULFONIUM TRIFLUOROMETHANESULFONATE;(4-FLUOROPHENYL)DIPHENYLSULFONIUM TRIFLA;Diphenyl(4-fluorophenyl)sulphonium trifluoromethanesulphonate;Biphenyl-4-fluorophenylsulfoniumtriflouromethanesulfonate;(4-Fluorophenyl)diphenylsulfonium triflate | | CAS: | 154093-57-9 | | MF: | C19H14F4O3S2 | | MW: | 430.44 | | EINECS: | | | Product Categories: | | | Mol File: | 154093-57-9.mol |  |
| | (4-Fluorophenyl)diphenylsulfonium triflate Chemical Properties |
| Melting point | 117-120 °C (lit.) | | λmax | 234 nm | | InChI | InChI=1S/C18H14FS.CHF3O3S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;2-1(3,4)8(5,6)7/h1-14H;(H,5,6,7)/q+1;/p-1 | | InChIKey | SGYQZOQILXLBIB-UHFFFAOYSA-M | | SMILES | [S+](C1=CC=CC=C1)(C1C=CC=CC=1)C1C=CC(F)=CC=1.C(F)(F)(F)S([O-])(=O)=O |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (4-Fluorophenyl)diphenylsulfonium triflate Usage And Synthesis |
| Uses | Cationic photoinitiator. Photoacid generator. | | Application | (4-Fluorophenyl)diphenylsulfonium triflate is mainly used in the chemical field as a cationic photoinitiator and photoacid generator. As a cationic photoinitiator, it decomposes under ultraviolet light to generate strong Lewis acids or Brønsted acids, thereby initiating cationic polymerization reactions. |
| | (4-Fluorophenyl)diphenylsulfonium triflate Preparation Products And Raw materials |
|