| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | N,S-Carboxymethyl Cysteine Basic information |
| Product Name: | N,S-Carboxymethyl Cysteine | | Synonyms: | N,S-Carboxymethyl Cysteine;Carbocisteine Impurity 12;(R)-2-((carboxymethyl)amino)-3-((carboxymethyl)thio)propanoicacidhydrochloride;"N,S-Carboxymethyl Cysteine Hydrochloride";(2R)-2-[(Carboxymethyl)amino]-3-[(carboxymethyl)sulfanyl]propanoic Acid;Carbocisteine Impurity 23;Acetylcysteine Impurity 10 HCl;N,S-bis-carboxymethyl-L-cysteine | | CAS: | 907565-13-3 | | MF: | C7H11NO6S | | MW: | 237.23 | | EINECS: | | | Product Categories: | | | Mol File: | 907565-13-3.mol |  |
| | N,S-Carboxymethyl Cysteine Chemical Properties |
| Melting point | 237 °C (decomp) | | Boiling point | 550.2±50.0 °C(Predicted) | | density | 1.569±0.06 g/cm3(Predicted) | | pka | 1.80±0.10(Predicted) | | InChI | InChI=1/C7H11NO6S/c9-5(10)1-8-4(7(13)14)2-15-3-6(11)12/h4,8H,1-3H2,(H,9,10)(H,11,12)(H,13,14)/t4-/s3 | | InChIKey | RELSCHWLFFGWGD-UFLUHPNLNA-N | | SMILES | [C@@H](C(=O)O)(CSCC(=O)O)NCC(=O)O |&1:0,r| |
| | N,S-Carboxymethyl Cysteine Usage And Synthesis |
| Uses | N,S-Dicarboxymethyl-L-cysteine is an impurity of carbocysteine. |
| | N,S-Carboxymethyl Cysteine Preparation Products And Raw materials |
|