|
|
| | Carbocisteine LactaM Basic information |
| | Carbocisteine LactaM Chemical Properties |
| Boiling point | 530.3±50.0 °C(Predicted) | | density | 1.455±0.06 g/cm3(Predicted) | | pka | 3.26±0.20(Predicted) | | InChI | InChI=1S/C5H7NO3S/c7-4-2-10-1-3(6-4)5(8)9/h3H,1-2H2,(H,6,7)(H,8,9)/t3-/m0/s1 | | InChIKey | ZCITVSIKDJSWSS-VKHMYHEASA-N | | SMILES | N1C(=O)CSC[C@H]1C(O)=O |
| | Carbocisteine LactaM Usage And Synthesis |
| Uses | Carbocisteine Lactam is an impurity of the mucolytic agent Carbocisteine (C178760). | | Uses | (3R)-5-Oxothiomorpholine-3-carboxylic Acid is used in the synthesis of Mercaptan and dicarboxylate inhibitors of hamster dihydroorotase |
| | Carbocisteine LactaM Preparation Products And Raw materials |
|