Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate manufacturers
|
| | Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate Basic information |
| Product Name: | Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate | | Synonyms: | CPD3502;Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate;trifluoro(2-fluoro-6-hydroxyphenyl)borate potassium(I);Potassium (2-fluoro-6-hydroxyphenyl) trifluoroborate;Borate(1-), trifluoro(2-fluoro-6-hydroxyphenyl)-, potassium (1:1);trifluoro-(2-fluoro-6-hydroxyphenyl)boranuide;(2-Fluoro-6-hydroxyphenyl)potassium trifluoroborate | | CAS: | 2252415-10-2 | | MF: | C6H4BF4KO | | MW: | 218 | | EINECS: | | | Product Categories: | | | Mol File: | 2252415-10-2.mol |  |
| | Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate Chemical Properties |
| storage temp. | 2-8°C, sealed storage, away from moisture | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4BF4O.K/c8-4-2-1-3-5(12)6(4)7(9,10)11;/h1-3,12H;/q-1;+1 | | InChIKey | KDSFFRRHNBFXRQ-UHFFFAOYSA-N | | SMILES | [B+3]([C-]1=C(C=CC=C1F)O)([F-])([F-])[F-].[K+] |
| | Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate Usage And Synthesis |
| Uses | Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate is used as organic synthesis and pharmaceutical intermediates. |
| | Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate Preparation Products And Raw materials |
|