|
|
| | 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt Basic information |
| Product Name: | 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt | | Synonyms: | 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt;4-oxadiazole-2-carboxylic acid potassium salt;5-Methyl-;5-methyl-1,3,4-oxadiazole-2-carboxylic acid(SALTDATA: FREE);5-methyl-1,3,4-oxadiazole-2-carboxylic acid potassium;5-Methyl-1,3,4-oxadiazole-2-carboxylic acid, potassiuM salt (1:1);potassiuM 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid;1,3,4-Oxadiazole-2-carboxylic acid, 5-Methyl-, potassiuM salt | | CAS: | 888504-28-7 | | MF: | C4H3KN2O3 | | MW: | 166.18 | | EINECS: | 618-215-9 | | Product Categories: | Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 888504-28-7.mol |  |
| | 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt Chemical Properties |
| Melting point | 258.3 °C (decomp) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Water | | form | Solid | | color | Off-White | | InChI | InChI=1S/C4H4N2O3.K/c1-2-5-6-3(9-2)4(7)8;/h1H3,(H,7,8);/q;+1/p-1 | | InChIKey | BRHMYHXNUGVBCU-UHFFFAOYSA-M | | SMILES | C1(C(=O)[O-])OC(C)=NN=1.[K+] |
| WGK Germany | 3 | | HS Code | 2918.99.4700 |
| | 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An intermediate in the preparation of HIV-integrase inhibitors. | | Synthesis | Synthesis of potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate (19b): potassium triethylsilanolate (411 mg, 3.20 mmol) was suspended in ethyl ether at room temperature and stirred to form a slurry. Subsequently, ethyl 5-methyl-1,3,4-oxadiazole-2-carboxylate (0.50 g, 3.20 mmol) was added at once. The reaction immediately produced a precipitate, which changed color from white to off-white. The precipitate was separated by filtration, washed with ether and dried to give the title compound as an off-white solid (580 mg, quantitative yield).1H NMR (300 MHz, CDCl3): δ 2.61 (3H, s). 13C NMR (75 MHz, D2O): δ 166.7, 161.3, 159.3, 10.4. | | References | [1] Patent: US2009/35324, 2009, A1. Location in patent: Page/Page column 12
[2] Patent: WO2016/127859, 2016, A1. Location in patent: Paragraph 00194
[3] Patent: CN106349233, 2017, A. Location in patent: Paragraph 0243; 0274; 0275; 0276
[4] Patent: WO2006/60711, 2006, A2. Location in patent: Page/Page column 30-31
[5] Patent: WO2006/60731, 2006, A2. Location in patent: Page/Page column 35-36 |
| | 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt Preparation Products And Raw materials |
|