| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 6-Nitroveratryl chloroformate Basic information |
| Product Name: | 6-Nitroveratryl chloroformate | | Synonyms: | NVOC CHLORIDE;NVOC-CL;((nitroveratryl)oxy)chlorocarbamate;6-NITROVERATRYL CHLOROFORMATE 97%;6-NITROVERATRYLOXYCARBONYL CHLORIDE;4,5-DIMETHOXY-2-NITROBENZYL CHLOROFORMATE;Chloroformic acid 6-nitroveratryl ester~4,5-Dimethoxy-2-nitrobenzyl chloroformate~NVOC-Cl;4,5-Dimethoxy-2-nitrobenzylchloroformate~NVOC-Cl | | CAS: | 42855-00-5 | | MF: | C10H10ClNO6 | | MW: | 275.64 | | EINECS: | | | Product Categories: | | | Mol File: | 42855-00-5.mol |  |
| | 6-Nitroveratryl chloroformate Chemical Properties |
| Melting point | 125 °C (dec.)(lit.) | | Boiling point | 396.4±42.0 °C(Predicted) | | density | 1.399±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | color | Pale yellow | | Water Solubility | Soluble in methanol, acetone. Reacts with water. | | Sensitive | Moisture & Light Sensitive | | BRN | 2389168 | | Major Application | peptide synthesis | | InChI | InChI=1S/C10H10ClNO6/c1-16-8-3-6(5-18-10(11)13)7(12(14)15)4-9(8)17-2/h3-4H,5H2,1-2H3 | | InChIKey | RWWPKIOWBQFXEE-UHFFFAOYSA-N | | SMILES | C(Cl)(OCC1=CC(OC)=C(OC)C=C1[N+]([O-])=O)=O |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2918999090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 6-Nitroveratryl chloroformate Usage And Synthesis |
| Uses | 4,5-Dimethoxy-2-nitrobenzyl chloroformate is used as a reagent for protection of amines, for use in N-protection of bases in nucleotide synthesis, photochemical protecting groups in organic synthesis. It is used as pharmaceutical intermediate. | | Uses | 4,5-Dimethoxy-2-nitrobenzyl chloroformate (NVOC-Cl) is a photolabile protecting reagent, commonly used in peptide or nucleotide synthesis to protect amines and hydroxyl groups. General applications are:
- Preparation of inactive, caged protein conjugates which can be activated by irradiating near-ultraviolet light.
- Solid-phase synthesis of base-sensitive S-acylthioethyl (SATE)-prooligonucleotides.
- Modification of surface properties by introducing photocleavable NVOC moiety into chitosan to control cell attachment.
|
| | 6-Nitroveratryl chloroformate Preparation Products And Raw materials |
|