|
|
| | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Basic information |
| Product Name: | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride | | Synonyms: | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride;Cyclobutanamine, 2-methoxy-, hydrochloride (1:1), (1R,2R)-;(1R, 2R)-2-Methoxy-cyclobutylamine hydrochloride;(1R,2R)-2-Methoxycyclobutanamine Hydrochloride;(1R,2R)-2-methoxyclobutylaminehydrochloride;(1R,2R)-2-methoxycyclobutanamine;27(1R,2R)-2-methoxycyclobutan-1-amine | | CAS: | 1820576-22-4 | | MF: | C5H12ClNO | | MW: | 137.60788 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 1820576-22-4.mol |  |
| | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Chemical Properties |
| storage temp. | Store at Room Tem. | | Appearance | white powder | | InChI | InChI=1/C5H11NO.ClH/c1-7-5-3-2-4(5)6;/h4-5H,2-3,6H2,1H3;1H/t4-,5-;/s3 | | InChIKey | ZVONGBUZWDPLLF-TXRIQCMBNA-N | | SMILES | O([C@@H]1CC[C@H]1N)C.Cl |&1:1,4,r| |
| | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Usage And Synthesis |
| | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Preparation Products And Raw materials |
|