| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Basic information |
| Product Name: | 2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine | | Synonyms: | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine;2-[2-(3,4-dimethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine;2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triaz;4,6-bis-(trichloromethyl)-2-(3,4-Dimethoxystyryl)-1,3,5-Triazine;2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine>1,3,5-Triazine, 2-[2-(3,4-dimethoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-;(E)-2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1 | | CAS: | 42880-07-9 | | MF: | C15H11Cl6N3O2 | | MW: | 477.98 | | EINECS: | | | Product Categories: | Functional Materials;Photopolymerization Initiators | | Mol File: | 42880-07-9.mol |  |
| | 2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Chemical Properties |
| Melting point | 188.0 to 192.0 °C | | Boiling point | 532.147±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.578±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | almost transparency in hot Toluene | | form | powder to crystal | | pka | -1.955±0.10(predicted) | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C15H11Cl6N3O2/c1-25-9-5-3-8(7-10(9)26-2)4-6-11-22-12(14(16,17)18)24-13(23-11)15(19,20)21/h3-7H,1-2H3 | | InChIKey | ZJRNXDIVAGHETA-UHFFFAOYSA-N | | SMILES | C(C1=NC(=NC(=N1)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)=CC1C=CC(=C(C=1)OC)OC |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2933.69.6050 |
| | 2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Usage And Synthesis |
| Uses | 2-(3,4-DIMETHOXYSTYRYL)-4,6-BIS(TRICHLOROMETHYL)-1,3,5-TRIAZINE is a pale yellow to yellow to orange crystalline powder, primarily used in the chemical industry as a photo-cationic polymerisation initiator and as an intermediate in the synthesis of photoactive materials. |
| | 2-(3,4-Dimethoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Preparation Products And Raw materials |
|