| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | BORIC-11B ACID Basic information |
| | BORIC-11B ACID Chemical Properties |
| density | 1.435 g/mL at 25 °C (lit.) | | InChI | InChI=1S/BH3O3/c2-1(3)4/h2-4H/i1+0 | | InChIKey | KGBXLFKZBHKPEV-IGMARMGPSA-N | | SMILES | [11B](O)(O)O | | CAS Number Unlabeled | 10043-35-3 |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-62-63 | | Safety Statements | 22-26-36/37/39-45 | | WGK Germany | 3 | | HS Code | 28459000 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Repr. 1B |
| | BORIC-11B ACID Usage And Synthesis |
| Chemical Properties | White powder |
| | BORIC-11B ACID Preparation Products And Raw materials |
|