| Company Name: |
LGM Pharma
|
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
| Products Intro: |
Product Name:Merbarone
CAS:97534-21-9
Purity:Typically NLT 98%
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Merbarone
CAS:97534-21-9
Purity:>=98% (HPLC) Package:25mg Remarks:M2070
|
|
| | MERBARONE Basic information |
| Product Name: | MERBARONE | | Synonyms: | 4,6-dioxo-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide;Merbarone - CAS 97534-21-9 - Calbiochem;5-(N-PHENYLCARBAMOYL)-2-THIOBARBITURIC ACID;5-(N-PHENYLCARBOXAMIDO)-2-THIOBARBITURIC ACID;NSC-336628;hexahydro-4,6-dioxo-n-phenyl-2-thioxo-5-pyrimidinecarboxamid;5-(N-Phenylcarbamoyl)-2-thiobarbituric acid, NSC-336628;MERBARONE | | CAS: | 97534-21-9 | | MF: | C11H9N3O3S | | MW: | 263.27 | | EINECS: | | | Product Categories: | | | Mol File: | 97534-21-9.mol |  |
| | MERBARONE Chemical Properties |
| density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: >5mg/mL | | pka | -2.16±0.20(Predicted) | | form | solid | | color | Pink to purple | | InChI | 1S/C11H9N3O3S/c15-8(12-6-4-2-1-3-5-6)7-9(16)13-11(18)14-10(7)17/h1-5H,(H,12,15)(H3,13,14,16,17,18) | | InChIKey | GFYRZTLCYQQVHZ-UHFFFAOYSA-N | | SMILES | Sc1nc(c(c(n1)O)C(=O)Nc2ccccc2)O |
| WGK Germany | 3 | | RTECS | UV7714625 | | Storage Class | 11 - Combustible Solids |
| | MERBARONE Usage And Synthesis |
| Uses | Merbarone has been used to study its effect on the occurrence of DNA lesions. | | General Description | A cell-permeable anticancer drug that inhibits the catalytic activity of topoisomerase II (topo II) without damaging DNA or stabilizing DNA-topo II cleavable complexes (IC50 = 20 μM for purified mammalian topo II versus IC50 = ~ 200 μM for topo I). Also induces apoptosis in human leukemic CEM cells through a caspase-3-like protease-dependent mechanism. | | Biochem/physiol Actions | Cell permeable: yes | | in vivo | Merbarone (50 mg/kg; daily i.p. for 5 d) achieves a maximum increased life span (ILS) of 101% in P388 murine leukemia[2].
Merbarone (124 mg/kg; daily p.o. for 9 d) has anti-tumor activity in mice[2]. |
| | MERBARONE Preparation Products And Raw materials |
|