| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:N,N-Bis[(1S)-(-)-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine
CAS:376355-58-7
Package:100mg;500mg
|
|
| | N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][ Basic information | | Reaction |
| Product Name: | N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][ | | Synonyms: | N,N-bis[(1R)-1-phenylethyl]-Dibenzo[d,f][1,3,2]dioxaphosphepin-6-aMine;N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][;BIPOL-A1(S), (S,S)-N-(5,7-Diox-6-phosphadibenzo[a,c]cyclohepten-6-yl)bis(1-phenylethyl)amine, O,Oμ-(2,2μ-Biphenyldiyl) N,N-bis[(S)-1-phenylethyl]phosphoramidite;N,N-Bis[(1S)-(-)-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine;N,N-Bis[(1R)-(+)-phenylethyl]dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine;1,1'-Biphenyl-2,2'-diyl bis((1S)-1-phenylethyl)phosphoramidite;Biphenyl-2,2'-diyl bis((1S)-1-phenylethyl)phosphoramidite;Dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine, N,N-bis[(1S)-1-phenylethyl]- | | CAS: | 376355-58-7 | | MF: | C28H26NO2P | | MW: | 439.49 | | EINECS: | | | Product Categories: | phosphine-amine ligand;Chiral Phosphine;CPN | | Mol File: | 376355-58-7.mol | ![N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][ Structure](CAS/GIF/376355-58-7.gif) |
| | N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][ Chemical Properties |
| Melting point | 99-102 °C | | Boiling point | 578.4±53.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | pka | -0.31±0.20(Predicted) | | color | white | | Optical Rotation | [α]/D -250±10°, c = 1 in toluene | | Sensitive | moisture sensitive | | InChI | 1S/C28H26NO2P/c1-21(23-13-5-3-6-14-23)29(22(2)24-15-7-4-8-16-24)32-30-27-19-11-9-17-25(27)26-18-10-12-20-28(26)31-32/h3-22H,1-2H3 | | InChIKey | JISGHECLGYELKD-UHFFFAOYSA-N | | SMILES | C[C@H](N([C@@H](C)c1ccccc1)P2Oc3ccccc3-c4ccccc4O2)c5ccccc5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][ Usage And Synthesis |
| Reaction |
- Ligand for the copper catalyzed, highly regioselective substitution reactions of a wide variety of aromatic substituted allylic halides to form branched chiral products from diverse Grignard reagents.
- Ligand for the copper catalyzed, highly enantioselective conjugate addition of diethylzinc to eneones and nitro olefins.
- Ligand for the nickel catalyzed, highly enantioselective hydrovinylation of alkenes.
- Ligand for the rhodium catalyzed, highly enantioselective hydroformylation of vinylarenes.
- Ligand for gold catalyzed asymmetric Intramolecular hydroamination of allenes
| | Uses | N,N-Bis-((S)-1-phenylethyl)dibenzo[d,f][1,3,2]dioxaphosphepin-6-amine can be used:
- In the iridium catalyzed allylic arylation.
- To prepare a copper complex (Cu2X2L3), which is used to detect the transmetalation intermediates in asymmetric addition reactions using ZnEt2.
| | reaction suitability | reaction type: click chemistry |
| | N N-BIS-[(S)-1-PHENYLETHYL]DIBENZO[D F][ Preparation Products And Raw materials |
|