| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | Ethylene glycol disuccinate bis(sulfo-n- Basic information |
| | Ethylene glycol disuccinate bis(sulfo-n- Chemical Properties |
| density | 1.85 | | storage temp. | −20°C | | solubility | water: soluble | | pka | -0.34±0.20(Predicted) | | form | powder | | color | White to off-white | | Water Solubility | water: soluble | | InChIKey | IYBKWXQWKPSYDT-UHFFFAOYSA-L | | SMILES | [Na+].[Na+].[S](=O)(=O)([O-])C1CC(=O)N(C1=O)OC(=O)CCC(=O)OCCOC(=O)CCC(=O)ON2C(=O)C(CC2=O)[S](=O)(=O)[O-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Ethylene glycol disuccinate bis(sulfo-n- Usage And Synthesis |
| Uses | Sulfo-EGS is a homobifunctional, amine-reactive chemical crosslinker. Sulfo-EGS is used to study protein-protein or protein-peptide interactions, which can determine the spatial proximity of amino acid residues in a protein complex, without relying on standards[1]. | | reaction suitability | reagent type: cross-linking reagent | | References | [1] Kalkhof S, et al., Chemical cross-linking and high-performance Fourier transform ion cyclotron resonance mass spectrometry for protein interaction analysis: application to a calmodulin/target peptide complex. Anal Chem. 2005 Jan 15;77(2):495-503. DOI:10.1021/ac0487294 |
| | Ethylene glycol disuccinate bis(sulfo-n- Preparation Products And Raw materials |
|