| Company Name: |
CovaChem, LLC. |
| Tel: |
+1815.714.8421 (direct) |
| Email: |
tonynooner@covachem.com |
|
| | m-Maleimidobenzoyl-N-hydroxysulfosuccinimide ester Basic information |
| | m-Maleimidobenzoyl-N-hydroxysulfosuccinimide ester Chemical Properties |
| storage temp. | -20°C | | solubility | water: soluble | | form | powder | | Water Solubility | water: soluble | | InChI | 1S/C15H10N2O9S.Na/c18-11-4-5-12(19)16(11)9-3-1-2-8(6-9)15(22)26-17-13(20)7-10(14(17)21)27(23,24)25;/h1-6,10H,7H2,(H,23,24,25);/q;+1/p-1 | | InChIKey | LKUULGDICDGFIQ-UHFFFAOYSA-M | | SMILES | O=C(C1=CC(N2C(C=CC2=O)=O)=CC=C1)ON3C(C(S(=O)([O-])=O)CC3=O)=O.[Na+] |
| Hazard Codes | Xi | | WGK Germany | WGK 3 | | HS Code | 2928009090 | | Storage Class | 11 - Combustible Solids |
| | m-Maleimidobenzoyl-N-hydroxysulfosuccinimide ester Usage And Synthesis |
| Uses | Bis(NHS)PEG5 is used in targeting M2-like tumor-associated macrophages by using melittin-based pro-apoptotic peptide conjugates with anti-cancer drugs, | | reaction suitability | reagent type: cross-linking reagent |
| | m-Maleimidobenzoyl-N-hydroxysulfosuccinimide ester Preparation Products And Raw materials |
|