| Company Name: |
Jilin Shengchuang Biotechnology Co., LTD Gold
|
| Tel: |
13251734045; 13251734045 |
| Email: |
396921152@qq.com |
| Products Intro: |
Product Name:5,6-Epoxy-5,6-dihydro-[1,10]phenanthroline CAS:65115-91-5 Purity:98% Package:1g;5g;25g
|
|
| | 5 6-EPOXY-5 6-DIHYDRO-(1 10)PHENANTHROL& Basic information |
| Product Name: | 5 6-EPOXY-5 6-DIHYDRO-(1 10)PHENANTHROL& | | Synonyms: | 1,10-phenanthroline 5,6-oxide;5,6-Epoxy-1,10-phenanthroline;5 6-EPOXY-5 6-DIHYDRO-(1 10)PHENANTHROL&;Oxireno[f][1,10]phenanthroline,1a,9b-dihydro-(9CI);5,6-Epoxy-5,6-dihydro-[1,10]phenanthroline 98%;Oxireno[f][1,10]phenanthroline,1a,9b-dihydro-;1a,9b-dihydrooxireno[2,3-f][1,10]phenanthroline;1a,9b-Dihydrooxireno[2,3-f][1,10]phenanthroline N | | CAS: | 65115-91-5 | | MF: | C12H8N2O | | MW: | 196.2 | | EINECS: | | | Product Categories: | EPOXYDE;API intermediates;Heterocyclic Building Blocks;N-Containing;Others | | Mol File: | 65115-91-5.mol |  |
| | 5 6-EPOXY-5 6-DIHYDRO-(1 10)PHENANTHROL& Chemical Properties |
| Melting point | 183 °C (dec.)(lit.) | | Boiling point | 408.2±35.0 °C(Predicted) | | density | 1.378±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.33±0.20(Predicted) | | InChI | InChI=1S/C12H8N2O/c1-3-7-9(13-5-1)10-8(4-2-6-14-10)12-11(7)15-12/h1-6,11-12H | | InChIKey | GGQHROHZSIPVQE-UHFFFAOYSA-N | | SMILES | N1C2=C(C3OC3C3=C2N=CC=C3)C=CC=1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5 6-EPOXY-5 6-DIHYDRO-(1 10)PHENANTHROL& Usage And Synthesis |
| Uses | 5,6-Epoxy-5,6-dihydro-[1,10]phenanthroline may be used to synthesize N-(3-azidopropyl)-1,10-phenanthrolin-5-amine (az-phen), via reaction with 3-azidopropylamine which is then subjected to dehydration by treatment with sodium hydride. It can also be used to synthesize (1,10-phenanthrolin-5-yl)-1-thio-β-D-glucopyranoside by reacting with 1-thio-β-D-glucopyranose sodium salt in dry ethanol. |
| | 5 6-EPOXY-5 6-DIHYDRO-(1 10)PHENANTHROL& Preparation Products And Raw materials |
|