| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-(2-(Methylsulfonyl)phenyl)acetamide Basic information |
| | N-(2-(Methylsulfonyl)phenyl)acetamide Chemical Properties |
| Melting point | 143.5-147.5 °C(lit.) | | Boiling point | 478.5±37.0 °C(Predicted) | | density | 1.297±0.06 g/cm3(Predicted) | | pka | 13.99±0.70(Predicted) | | form | crystalline solid | | color | Faint to light brown | | InChI | 1S/C9H11NO3S/c1-7(11)10-8-5-3-4-6-9(8)14(2,12)13/h3-6H,1-2H3,(H,10,11) | | InChIKey | NGWCPCSZLLJKPD-UHFFFAOYSA-N | | SMILES | CC(=O)Nc1ccccc1S(C)(=O)=O |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 2930909899 | | Storage Class | 13 - Non Combustible Solids |
| | N-(2-(Methylsulfonyl)phenyl)acetamide Usage And Synthesis |
| Uses | N-Acetyl-2-(methylsulphonyl)aniline is an intermediate for organic synthesis. |
| | N-(2-(Methylsulfonyl)phenyl)acetamide Preparation Products And Raw materials |
|