| Company Name: |
goldenchemical Gold |
| Tel: |
18651817751 |
| Email: |
xisiyu@goldenchemical.com |
|
| | 2-Bromo-5-phenyl-1,3,4-thiadiazole Basic information |
| | 2-Bromo-5-phenyl-1,3,4-thiadiazole Chemical Properties |
| Melting point | 86-90 °C | | Boiling point | 125-130 °C(Press: 0.4 Torr) | | density | 1.642±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | -1.88±0.10(Predicted) | | form | powder | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C8H5BrN2S/c9-8-11-10-7(12-8)6-4-2-1-3-5-6/h1-5H | | InChIKey | NVQXBSUUWVZRCA-UHFFFAOYSA-N | | SMILES | S1C(C2=CC=CC=C2)=NN=C1Br |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-5-phenyl-1,3,4-thiadiazole Usage And Synthesis |
| | 2-Bromo-5-phenyl-1,3,4-thiadiazole Preparation Products And Raw materials |
|