| Company Name: |
langwaychem Gold |
| Tel: |
21-67639201 13601755340 |
| Email: |
customer@langwaychem.com |
6-Bromo-3-pyridazinecarboxylic acid manufacturers
|
| | 6-Bromo-3-pyridazinecarboxylic acid Basic information |
| | 6-Bromo-3-pyridazinecarboxylic acid Chemical Properties |
| Melting point | 149-150 °C | | Boiling point | 436.0±30.0 °C(Predicted) | | density | 1.940±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 2.68±0.10(Predicted) | | Appearance | light gray solid | | InChI | InChI=1S/C5H3BrN2O2/c6-4-2-1-3(5(9)10)7-8-4/h1-2H,(H,9,10) | | InChIKey | QYLYERSOVJIZLK-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NN=C(Br)C=C1 |
| RIDADR | UN2811 | | HS Code | 2933998090 |
| | 6-Bromo-3-pyridazinecarboxylic acid Usage And Synthesis |
| | 6-Bromo-3-pyridazinecarboxylic acid Preparation Products And Raw materials |
|