| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] Basic information |
| Product Name: | 1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] | | Synonyms: | 1-ETHYL-3-ME-IMIDAZOLIUM BIS(PENTAFLUOROETHYLSULFONYL)IMIDE;[emibeti];1-ETHYL-3-METHYLIMIDAZOLIUM BIS(PENTAFLUOROETHYLSULFONYL)IMIDE [EMIBETI];bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide:1-ethyl-3-methylimidazol-3-ium;1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide >=97.0% (H-NMR);1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] | | CAS: | 216299-76-2 | | MF: | C6H11N2.C4F10NO4S2 | | MW: | 491.326 | | EINECS: | | | Product Categories: | organic amine | | Mol File: | 216299-76-2.mol | ![1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] Structure](CAS/GIF/216299-76-2.gif) |
| | 1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] Chemical Properties |
| Melting point | ≤−1 °C(lit.) | | density | 1,57 g/cm3 | | form | liquid | | Specific Gravity | 1.57 | | color | colorless to pale yellow | | InChI | 1S/C6H11N2.C4F10NO4S2/c1-3-8-5-4-7(2)6-8;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h4-6H,3H2,1-2H3;/q+1;-1 | | InChIKey | SUDHVXIPIDQEIT-UHFFFAOYSA-N | | SMILES | CCn1cc[n+](C)c1.FC(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)F |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | F | 10 | | Storage Class | 12 - Non Combustible Liquids |
| | 1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] Usage And Synthesis |
| Uses | 1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide can be used:
- As a model ionic liquid in the preparation of supported ionic liquid membranes (SILMs), which are employed in the studies of CO2and N2gas permeation.
- In the studies of solubility and absorption of 1,1,1,2-tetrafluoroethane, difluoromethane, and fluorinated ethanes in ionic liquids.
- As a medium for the electro-polymerizationof pyrrole based monomers to yield N-(methyl)phenylpolypyrroles.
|
| | 1-Ethyl-3-methylimidazolium bis(pentafluoroethylsulfonyl)imide, 99% [emibeti] Preparation Products And Raw materials |
|