OPEN RING AZTREONAM manufacturers
|
| | OPEN RING AZTREONAM Basic information |
| Product Name: | OPEN RING AZTREONAM | | Synonyms: | Aztreonam USP Related Compound A (Open-ring Aztreonam);OPEN RING AZTREONAM (25 MG);SQ 26992;Open Ring Aztreonam (15 mg);(2S,3S)-2-[[(2Z)-2-(2-Amino-4-thiazolyl)-2-[(1-carboxy-1-methylethoxy)imino]acetyl]amino]-3-(sulfoamino)butanoic Acid;Open Ring Aztreonam (10 mg);Open Ring AztreonaM;AztreonaM IMpurity A | | CAS: | 87500-74-1 | | MF: | C13H19N5O9S2 | | MW: | 453.45 | | EINECS: | | | Product Categories: | | | Mol File: | 87500-74-1.mol |  |
| | OPEN RING AZTREONAM Chemical Properties |
| Melting point | >182°C (dec.) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChIKey | IBLNMEMSULYOOK-VEHQQRBSSA-N | | SMILES | C(O)(=O)[C@@H](NC(/C(/C1=CSC(N)=N1)=N\OC(C(O)=O)(C)C)=O)[C@@H](NS(O)(=O)=O)C |
| WGK Germany | WGK 3 | | HS Code | 2934100000 | | Storage Class | 11 - Combustible Solids |
| | OPEN RING AZTREONAM Usage And Synthesis |
| Uses | An metabolite of Aztreonam (A965200), the first totally synthetic monocyclic β-lactam antibiotic. | | Definition | ChEBI: A 1,3-thiazole that is obtained via biohydrolysis of the beta-lactam ring of aztreonam. |
| | OPEN RING AZTREONAM Preparation Products And Raw materials |
|