| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Products Intro: |
Product Name:6-a-Sialyl-N-acetyllactosamine sodium salt CAS:174757-71-2
|
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310; |
| Email: |
3003867561@qq.com |
| Products Intro: |
Product Name:6′-Sialyl-N-acetyllactosamine CAS:174757-71-2 Purity:HPLC>=98% Package:20mg
|
| Company Name: |
Shanghai Saikerui Biotechnology Co. , Ltd.
|
| Tel: |
021-58000709 13162935620 |
| Email: |
sales@scrbio.com |
| Products Intro: |
Product Name:6'-Sialyl-N-acetyllactosamine CAS:174757-71-2 Purity:98% Package:1mg;5mg;10mg
|
| Company Name: |
Shanghai Kasons Biotech Co., Ltd.
|
| Tel: |
18616988519 |
| Email: |
sales_bcs@126.com |
| Products Intro: |
Product Name:6’-Sialyl-N-acetyllactosamine CAS:174757-71-2 Purity:99% Package:10mg; 100mg; 1g; 10g; 100g; 1kg
|
|
| | 6-SIALYL-N-ACETYLLACTOSAMINE* Basic information |
| | 6-SIALYL-N-ACETYLLACTOSAMINE* Chemical Properties |
| Boiling point | 1196.7±65.0 °C(Predicted) | | density | 1.66±0.1 g/cm3(Predicted) | | storage temp. | room temp | | pka | 2.01±0.70(Predicted) | | form | powder or crystals | | color | colorless | | biological source | synthetic | | InChIKey | RPSBVJXBTXEJJG-RAMSCCQBSA-N | | SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[C@]3(C[C@H](O)[C@@H](NC(C)=O)[C@@H](O3)[C@H](O)[C@H](O)CO)C(O)=O)[C@H](O)[C@H](O)[C@H]2O)[C@@H]1O |
| WGK Germany | 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | 6-SIALYL-N-ACETYLLACTOSAMINE* Usage And Synthesis |
| Uses | 6′-Sialyl-N-acetyllactosamine is an oligosaccharide. It is reported that the level of Neu5Ac-a-(2-6)-Gal-b-(1-4)-GlcNAc increases during tumor development in transgenic mice as compared to controls. | | Definition | ChEBI: (2R,4S,5R,6R)-5-Acetamido-2-[[(2R,3R,4S,5R,6S)-6-[(2R,3S,4R,5R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid is a member of neuraminic acids. |
| | 6-SIALYL-N-ACETYLLACTOSAMINE* Preparation Products And Raw materials |
|