| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
O-Benzotriazol-1-yl-n N n' N'-bis(penta& manufacturers
|
| | O-Benzotriazol-1-yl-n N n' N'-bis(penta& Basic information |
| Product Name: | O-Benzotriazol-1-yl-n N n' N'-bis(penta& | | Synonyms: | 1-(((1H-Benzo[d][1,2,3]triazol-1-yl)oxy)(piperidin-1-yl)methylene)piperidin-1-ium hexafluorophosphate(V);O-BENZOTRIAZOL-1-YL-N,N,N',N'-BIS(PENTA- METHYLENE)URONIUM PF6, 98%;O-(Benzotriazol-1-yl;O-Benzotriazol-1-yl-N,N,N`,N`-bis(pentaMethylene)uroniuM hexafluorophosphate,98%;O-(Benzotriazol-1-yl)-N,N,N',N'-bis(pentamethylene)uronium Hexafluorophosphate >;Piperidinium, 1-[(1H-benzotriazol-1-yloxy)-1-piperidinylmethylene]-, hexafluorophosphate(1-) (1:1);O-(Benzotriazol-1-yl)-N,N,N',N'-bis(pentamethylene)uronium Hexafluorophosphate;1H-Benzotriazol-1-yl(di-1-piperidinylmethylene)oxonium hexafluoro phosphate | | CAS: | 206752-41-2 | | MF: | C17H24F6N5OP | | MW: | 459.3695402 | | EINECS: | | | Product Categories: | Coupling;Peptide Synthesis;Phosphonium/Uronium/Formamidinium;Phosphonium/Uronium/FormamidiniumSynthetic Reagents | | Mol File: | 206752-41-2.mol |  |
| | O-Benzotriazol-1-yl-n N n' N'-bis(penta& Chemical Properties |
| Melting point | 206 °C (dec.)(lit.) | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C17H24N5O.F6P/c1-5-11-20(12-6-1)17(21-13-7-2-8-14-21)23-22-16-10-4-3-9-15(16)18-19-22;1-7(2,3,4,5)6/h3-4,9-10H,1-2,5-8,11-14H2;/q+1;-1 | | InChIKey | YNOBMGHLCWIWCL-UHFFFAOYSA-N | | SMILES | N1(O/C(=[N+]2/CCCCC/2)/N2CCCCC2)C2=CC=CC=C2N=N1.[P-](F)(F)(F)(F)(F)F |
| | O-Benzotriazol-1-yl-n N n' N'-bis(penta& Usage And Synthesis |
| Uses | O-BENZOTRIAZOL-1-YL-N N N' N'-BIS(PENTA& exhibits very high reactivity for peptide synthesis. |
| | O-Benzotriazol-1-yl-n N n' N'-bis(penta& Preparation Products And Raw materials |
|