| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(4-Methylphenyl)-5-(trifluoromethyl)-& Basic information |
| | 1-(4-Methylphenyl)-5-(trifluoromethyl)-& Chemical Properties |
| Melting point | 151-155 °C(lit.) | | Boiling point | 377.8±42.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | pka | 2.80±0.36(Predicted) | | form | solid | | InChI | 1S/C12H9F3N2O2/c1-7-2-4-8(5-3-7)17-10(12(13,14)15)9(6-16-17)11(18)19/h2-6H,1H3,(H,18,19) | | InChIKey | QMBUSCJEARRTEH-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)-n2ncc(C(O)=O)c2C(F)(F)F |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(4-Methylphenyl)-5-(trifluoromethyl)-& Usage And Synthesis |
| | 1-(4-Methylphenyl)-5-(trifluoromethyl)-& Preparation Products And Raw materials |
|