|
|
| | Diphenyl(ethyl)sulphonium tetrafluoroborate, 97 Basic information |
| Product Name: | Diphenyl(ethyl)sulphonium tetrafluoroborate, 97 | | Synonyms: | Ethyl(diphenyl)sulphonium fluoroborate;Diphenyl(ethyl)sulfoniumtetrafluoroborate;Ethyl(diphenyl)sulfoniumfluoroborate;ethyl(diphenyl)sulfanium,tetrafluoroborate;Diphenyl(ethyl)sulphonium tetrafluoroborate, 97 | | CAS: | 893-69-6 | | MF: | C14H15BF4S | | MW: | 302.1385128 | | EINECS: | | | Product Categories: | | | Mol File: | 893-69-6.mol |  |
| | Diphenyl(ethyl)sulphonium tetrafluoroborate, 97 Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H15S.BF4/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;2-1(3,4)5/h3-12H,2H2,1H3;/q+1;-1 | | InChIKey | OMJIKEGJWFKACN-UHFFFAOYSA-N | | SMILES | [S+](CC)(C1C=CC=CC=1)C1=CC=CC=C1.[B-](F)(F)(F)F |
| | Diphenyl(ethyl)sulphonium tetrafluoroborate, 97 Usage And Synthesis |
| | Diphenyl(ethyl)sulphonium tetrafluoroborate, 97 Preparation Products And Raw materials |
|