Metrafenone manufacturers
- metrafenone
-
-
2026-07-14
- CAS:220899-03-6
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 20tons
- METRAFENONE
-
-
2026-06-30
- CAS:220899-03-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Metrafenone Basic information |
| Product Name: | Metrafenone | | Synonyms: | Metrafenone@100 μg/mL in Acetonitrile;Metrafenone@1000 μg/mL in Acetonitrile;Methanone, (3-bromo-6-methoxy-2-methylphenyl)(2,3,4-trimethoxy-6-methylphenyl)-;(3-bromo-6-methoxy-2-methylphenyl)(2,3,4-trimethoxy-6-methyl...;(3-Bromo-6-methoxy-2-methylphenyl)(2,3,4-trimethoxy-6-methylphenyl)methanone;Empagliflozin Impurity 209;C15190000 Metrafenone;L15190000ALMetrafenonE10μg/mLin Acetonitril | | CAS: | 220899-03-6 | | MF: | C19H21BrO5 | | MW: | 409.27 | | EINECS: | | | Product Categories: | | | Mol File: | 220899-03-6.mol |  |
| | Metrafenone Chemical Properties |
| Boiling point | 534.4±50.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | Henry's Law Constant | 7.6×100 mol/(m3Pa) at 25℃, Maniere et al. (2011) | | Major Application | agriculture
environmental | | InChI | 1S/C19H21BrO5/c1-10-9-14(23-4)18(24-5)19(25-6)15(10)17(21)16-11(2)12(20)7-8-13(16)22-3/h7-9H,1-6H3 | | InChIKey | AMSPWOYQQAWRRM-UHFFFAOYSA-N | | SMILES | COc1ccc(Br)c(C)c1C(=O)c2c(C)cc(OC)c(OC)c2OC | | LogP | 5.190 (est) | | EPA Substance Registry System | Methanone, (3-bromo-6-methoxy-2-methylphenyl)(2,3,4-trimethoxy-6-methylphenyl)- (220899-03-6) |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | Metrafenone Usage And Synthesis |
| Uses | Metrafenone is a fungicide used in pesticide formulations in the protection of vegetation and crops. | | Production Methods | Metrafenone is commercially produced through a specialized organic synthesis process tailored for its use as a fungicide. While detailed production steps are proprietary and not widely disclosed, the synthesis typically involves constructing a benzophenone backbone with specific substitutions that confer antifungal activity. The process includes controlled reactions such as acylation and halogenation, followed by purification to achieve high chemical purity—often exceeding 99% for agricultural formulations. | | Definition | ChEBI: A member of the class of benzophenones that is benzophenone in which one of the phenyl groups is substituted by methoxy groups at positions 2, 3, and 4 and by a methyl group at position 6, while the other is substituted at positions 2, 3, and 6 by methyl,
romine, and methoxy groups, respectively. A fungicide with protectant and curative properties, it is used for the control of powdery mildew in cereals and grape vines. | | Mechanism of action | Protective and curative action. Interferes with hyphal morphogenesis. | | Pesticide Type | Fungicide |
| | Metrafenone Preparation Products And Raw materials |
|