| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- manufacturers
- GSK962
-
- $31.00
-
2026-08-08
- CAS:2049872-86-6
- Purity: 99.75%
- Supply Ability: 10g
|
| | 1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- Basic information |
| Product Name: | 1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- | | Synonyms: | 1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl-;GSK-962,GSK962;2,2-dimethyl-1-[(5R)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]propan-1-one;GSK'962;GSK962, 10 mM in DMSO | | CAS: | 2049872-86-6 | | MF: | C14H18N2O | | MW: | 230.31 | | EINECS: | | | Product Categories: | | | Mol File: | 2049872-86-6.mol | ![1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- Structure](CAS/20200515/GIF/2049872-86-6.gif) |
| | 1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- Chemical Properties |
| Boiling point | 342.8±45.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:75.0(Max Conc. mg/mL);325.65(Max Conc. mM) | | form | Solid | | pka | 0.98±0.40(Predicted) | | color | Light yellow to yellow | | SMILES | O=C(C(C)(C)C)N1[C@@H](C2=CC=CC=C2)CC=N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- Usage And Synthesis |
| Uses | GSK''962 is an inactive enantiomer of GSK''963, which is a novel highly potent and selective RIP1 inhibitor. | | Biological Activity | GSKμ962 (GSKμ962A) corresponds to the inactive (R)-enantiomer of the highly potent and selective RIPK1 (RIP1) inhibitor GSKμ963 (GSKμ963A). GSKμ962 serves as an ideal GSKμ963 negative control compound for probing RIPK1-mediated responses both in vitro and in vivo. |
| | 1-Propanone, 1-[(5R)-4,5-dihydro-5-phenyl-1H-pyrazol-1-yl]-2,2-dimethyl- Preparation Products And Raw materials |
|