| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | METHACRIFOS Basic information |
| | METHACRIFOS Chemical Properties |
| Melting point | <25℃ | | Boiling point | 90℃ | | density | 1.250±0.06 g/cm3(Predicted) | | storage temp. | APPROX 4°C | | form | liquid | | Merck | 13,5966 | | Henry's Law Constant | 1.0×101 mol/(m3Pa) at 25℃, MacBean (2012) | | Major Application | agriculture
environmental | | InChI | 1S/C7H13O5PS/c1-6(7(8)9-2)5-12-13(14,10-3)11-4/h5H,1-4H3/b6-5+ | | InChIKey | NTAHCMPOMKHKEU-AATRIKPKSA-N | | SMILES | COC(=O)\C(C)=C\OP(=S)(OC)OC |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | RTECS | UD3335000 | | HS Code | 29201900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 | | Toxicity | LD50 in rats (mg/kg): 678 orally; >3100 dermally (Wyniger) |
| | METHACRIFOS Usage And Synthesis |
| Uses | trans-Methacrifos is used as a pesticide used to protect crops and vegetation. | | Uses | Grain protectant, insecticide, acaricide. | | Definition | ChEBI: Methacrifos is an organic thiophosphate. | | Production Methods | Methacrifos is commercially produced through specialized chemical synthesis thatm begins with the preparation of key intermediates such as dimethoxyphosphinothioyl chloride, which is then reacted with methyl methacrylate or related acrylic esters to form the active compound methyl (E)-3-dimethoxyphosphinothioyloxy-2-methylprop-2-enoate. The reaction is conducted in liquid phase at low temperatures to maintain product stability, followed by purification steps to ensure high-quality yield. | | Mechanism of action | Stomach, contact and respiratory action with rapid knockdown and some residual activity. Acetylcholinesterase (AchE) inhibitor. | | Metabolism | Methacrifos administered in animals is
rapidly metabolized and excreted. The carboxy methyl
ester bond is cleaved as well as the phosphoryl methyl and
vinyl ester bonds. Oxidative desulfuration also occurs. | | Toxicity evaluation | The acute oral LD50 for rats is
678 mg/kg. Inhalation LC50 (4 h) for rats is 2.2 mg/L
air. NOEL (2 yr) for rats is 0.6 mg/kg b.w. daily. ADI
is 6 μg/kg b.w. | | Pesticide Type | Insecticide; Acaricide |
| | METHACRIFOS Preparation Products And Raw materials |
|