| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 5-ACETYL-2-NORBORNENE
-
- $1.10
-
2026-08-20
- CAS:5063-03-6
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 5-ACETYL-2-NORBORNENE Basic information |
| Product Name: | 5-ACETYL-2-NORBORNENE | | Synonyms: | 2-ACETYL-5-NORBORNENE;1-BICYCLO[2.2.1]HEPT-5-EN-2-YL-ETHANONE;5-NORBORNENE-2-ACETYL;ACETYLNORBORNENE;5-ACETYL-2-NORBORNENE;5-ACETYLBICYCLO[2.2.1]HEPT-2-ENE;Bicyclo[2.2.1]hept-2-ene, 5-acetyl-;Bicyclo[2.2.1]hept-5-ene, 2-acetyl- | | CAS: | 5063-03-6 | | MF: | C9H12O | | MW: | 136.19 | | EINECS: | 225-767-0 | | Product Categories: | Norbornene Derivatives | | Mol File: | 5063-03-6.mol |  |
| | 5-ACETYL-2-NORBORNENE Chemical Properties |
| Boiling point | 84-86 °C18 mm Hg(lit.) | | density | 1.005 g/mL at 25 °C(lit.) | | vapor pressure | 45.33Pa at 25℃ | | refractive index | n20/D 1.484(lit.) | | Fp | 143 °F | | storage temp. | 4°C | | solubility | Chloroform, Methanol (Slightly) | | form | Liquid | | Specific Gravity | 1.005 | | color | Clear light yellow to yellow-brown | | InChI | 1S/C9H12O/c1-6(10)9-5-7-2-3-8(9)4-7/h2-3,7-9H,4-5H2,1H3/t7-,8+,9/m1/s1 | | InChIKey | NIMLCWCLVJRPFY-WGTSGOJVSA-N | | SMILES | CC(=O)C1C[C@H]2C[C@@H]1C=C2 | | LogP | 2.05 | | CAS DataBase Reference | 5063-03-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25-37-26 | | RIDADR | 1993 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29142990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-ACETYL-2-NORBORNENE Usage And Synthesis |
| Chemical Properties | clear light yellow to yellowish-brown liquid | | Uses | 2-Acetyl-5-norbornene was used in the synthesis of the 2-acetylnorbornyl isothiocyanates: exo-2-acetyl-exo-6-isothiocyanatonorbornane, endo-2-acetyl-exo-6-isothiocyanatonorbornane and exo-2-acetyl-exo-5-isothiocyanatonorbornane. | | Uses | 5-Acetyl-2-norbornene is an intermediate used in the synthesis of the 2-acetylnorbornyl isothiocyanates. | | General Description | 2-Acetyl-5-norbornene, mixture of endo and exo is a colorless to light yellow liquid. | | Synthesis | The general procedure for synthesizing endo-5-acetyl-2-norbornene from endo-5-acetyl-2-norbornene was as follows: in a sealed vessel equipped with a 15 mL stir bar, 6.81 g (50 mmol) of 2-acetyl-5-norbornene (containing 18.7% of the exoform and 79.7% of the endoform isomer, and the ratio of the exoform to the endoform isomer was 0.23) as component (A), followed by the addition of 0.21 g (2.5 mmol) of N-methylpyrrolidine. The vessel was sealed under nitrogen protection and the reaction mixture was placed in a thermostatic bath and the reaction was stirred sequentially at 100 °C, 120 °C and 140 °C for 2 h each to promote the differential isomerization reaction. The reaction process was monitored by gas chromatography (GC) and the results of GC analysis were recorded in Table 6. | | References | [1] Patent: JP2015/3879, 2015, A. Location in patent: Paragraph 0039-0041 |
| | 5-ACETYL-2-NORBORNENE Preparation Products And Raw materials |
|