| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
7-(Diethylamino)coumarin-3-carboxylic acid ethyl ester manufacturers
- hMAO-B-IN-32
-
- $29.00
-
2026-07-13
- CAS:28705-46-6
- Purity: 99.97%
- Supply Ability: 10g
|
| | 7-(Diethylamino)coumarin-3-carboxylic acid ethyl ester Basic information |
| Product Name: | 7-(Diethylamino)coumarin-3-carboxylic acid ethyl ester | | Synonyms: | RARECHEM AB KA K019;ETHYL 7-(DIETHYLAMINO)COUMARIN-3-CARBOXYLATE;S0679;ethyl 7-(diethylamino)-2-oxochromene-3-carboxylate;ETHYL 7-DIETHYLAMINO-COUMARIN-3-CARBOXYLATE: 98.5%;2-Oxo-7-(diethylamino)-2H-1-benzopyran-3-carboxylic acid ethyl ester;7-(Diethylamino)-2-oxo-2H-1-benzopyran-3-carboxylic acid ethyl ester;7-Diethylamino-2-oxo-2H-1-benzopyran-3-carboxylic acid ethyl ester | | CAS: | 28705-46-6 | | MF: | C16H19NO4 | | MW: | 289.33 | | EINECS: | | | Product Categories: | | | Mol File: | 28705-46-6.mol |  |
| | 7-(Diethylamino)coumarin-3-carboxylic acid ethyl ester Chemical Properties |
| Melting point | 86 °C | | Boiling point | 455.6±45.0 °C(Predicted) | | density | 1.204 | | Fp | 229.3℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.83±0.20(Predicted) | | color | Light yellow to Amber to Dark green | | InChI | InChI=1S/C16H19NO4/c1-4-17(5-2)12-8-7-11-9-13(15(18)20-6-3)16(19)21-14(11)10-12/h7-10H,4-6H2,1-3H3 | | InChIKey | MSOLGAJLRIINNF-UHFFFAOYSA-N | | SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C(OCC)=O | | EPA Substance Registry System | 2H-1-Benzopyran-3-carboxylic acid, 7-(diethylamino)-2-oxo-, ethyl ester (28705-46-6) |
| TSCA | TSCA listed | | HS Code | 29322090 |
| | 7-(Diethylamino)coumarin-3-carboxylic acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 7-(diethylamino)-2-oxo-2H-chromene-3-carboxylate is a potent and selective inhibitor of hMAO-B with an IC50 of 45.52 μM[1]. | | References | [1] Secci D, et al. Synthesis and selective human monoamine oxidase inhibition of 3-carbonyl, 3-acyl, and 3-carboxyhydrazido coumarin derivatives. Eur J Med Chem. 2011 Oct;46(10):4846-52. DOI:10.1016/j.ejmech.2011.07.017 |
| | 7-(Diethylamino)coumarin-3-carboxylic acid ethyl ester Preparation Products And Raw materials |
|