| Company Name: |
Hangzhou Xingui Industrial Co., Ltd. Gold
|
| Tel: |
0571-86692169 15397065278 |
| Email: |
476137679@qq.com |
| Products Intro: |
Product Name:4-Benzoyloxybenzoic Acid CAS:28547-23-1 Purity:98% Package:25KG
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Para-Benzoyloxybenzoic Acid CAS:28547-23-1 Package:2.5g,25g
|
|
| | 4-BENZOYLOXYBENZOIC ACID Basic information |
| | 4-BENZOYLOXYBENZOIC ACID Chemical Properties |
| Melting point | 220 °C | | Boiling point | 424.1±28.0 °C(Predicted) | | density | 1.306±0.06 g/cm3(Predicted) | | pka | 4.07±0.10(Predicted) | | InChI | InChI=1S/C14H10O4/c15-13(16)10-6-8-12(9-7-10)18-14(17)11-4-2-1-3-5-11/h1-9H,(H,15,16) | | InChIKey | OUANAAHOQVMJCH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OC(=O)C2=CC=CC=C2)C=C1 | | EPA Substance Registry System | Benzoic acid, 4-(benzoyloxy)- (28547-23-1) |
| | 4-BENZOYLOXYBENZOIC ACID Usage And Synthesis |
| Uses | Para-Benzoyloxybenzoic Acid, is an intermediate in the synthesis of pyridazinone derivatives, acting as platelet aggregation inhibitors. |
| | 4-BENZOYLOXYBENZOIC ACID Preparation Products And Raw materials |
|