|
|
| | 1,1,2,3-TETRACHLOROPROPANE Basic information |
| Product Name: | 1,1,2,3-TETRACHLOROPROPANE | | Synonyms: | 1,1,2,3-TETRACHLOROPROPANE;1,1,2,3-tetrachloro-propan;propane,1,1,2,3-tetrachloro-;1,1,2,3-Tetrachloropropane > | | CAS: | 18495-30-2 | | MF: | C3H4Cl4 | | MW: | 181.88 | | EINECS: | 242-379-7 | | Product Categories: | | | Mol File: | 18495-30-2.mol |  |
| | 1,1,2,3-TETRACHLOROPROPANE Chemical Properties |
| Melting point | 179°C | | Boiling point | 179 °C | | density | 1,53 g/cm3 | | refractive index | 1.4990-1.5010 | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | InChI | InChI=1S/C3H4Cl4/c4-1-2(5)3(6)7/h2-3H,1H2 | | InChIKey | BUQMVYQMVLAYRU-UHFFFAOYSA-N | | SMILES | C(Cl)(Cl)C(Cl)CCl | | EPA Substance Registry System | Propane, 1,1,2,3-tetrachloro- (18495-30-2) |
| | 1,1,2,3-TETRACHLOROPROPANE Usage And Synthesis |
| | 1,1,2,3-TETRACHLOROPROPANE Preparation Products And Raw materials |
|