|
|
| | 4-Trifluoromethyl-2,3,5,6-tetrafluorothiophenol Basic information |
| Product Name: | 4-Trifluoromethyl-2,3,5,6-tetrafluorothiophenol | | Synonyms: | 4-(TRIFLUOROMETHYL)TETRAFLUOROTHIOPHENOL;4-MERCAPTO-ALPHA,ALPHA,ALPHA,2,3,5,6-HEPTAFLUOROTOLUENE;2,3,5,6-TETRAFLUORO-4-(TRIFLUOROMETHYL)BENZENETHIOL;4-(Trifluoromethyl)tetrafluorothiophenol 97%;4-(Trifluoromethyl)tetrafluorothiophenol97%;4-TRIFLUOROMETHYL-2,3,5,6-TETRAFLUOROTHIOPHENOL 97+%;4-(Trifluoromethyl)-2,3,5,6-tetrafluorothiophenol,98%;TETRAFLUORO-4-(TRIFLUOROMETHYL)THIOPHENOL | | CAS: | 651-84-3 | | MF: | C7HF7S | | MW: | 250.14 | | EINECS: | | | Product Categories: | | | Mol File: | 651-84-3.mol |  |
| | 4-Trifluoromethyl-2,3,5,6-tetrafluorothiophenol Chemical Properties |
| Boiling point | 169 °C | | density | 1.66 | | refractive index | 1.442-1.444 | | pka | 2.83±0.50(Predicted) | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.66 | | InChI | 1S/C7HF7S/c8-2-1(7(12,13)14)3(9)5(11)6(15)4(2)10/h15H | | InChIKey | BXMOMKVOHOSVJH-UHFFFAOYSA-N | | SMILES | Fc1c(F)c(c(F)c(F)c1S)C(F)(F)F | | CAS DataBase Reference | 651-84-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29309099 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 4-Trifluoromethyl-2,3,5,6-tetrafluorothiophenol Usage And Synthesis |
| Chemical Properties | clear colorless liquid |
| | 4-Trifluoromethyl-2,3,5,6-tetrafluorothiophenol Preparation Products And Raw materials |
|