| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:Methyl 2-amino-3,4,5-trimethoxybenzoate
CAS:5035-82-5
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:Methyl 3,4,5-trimethoxyanthranilate
CAS:5035-82-5
Purity:98% Remarks:B351078
|
|
| | Methyl 2-amino-3,4,5-trimethoxybenzoate Basic information |
| Product Name: | Methyl 2-amino-3,4,5-trimethoxybenzoate | | Synonyms: | TIMTEC-BB SBB000807;3,4,5-TRIMETHOXYANTHRANILIC ACID METHYL ESTER;METHYL 2-AMINO-3,4,5-TRIMETHOXYBENZOATE;METHYL 3,4,5-TRIMETHOXYANTHRANILATE;Anthranilic acid, 3,4,5-trimethoxy-, methyl ester;Benzoic acid, 2-amino-3,4,5-trimethoxy-, methyl ester;2-Amino-3,4,5-trimethoxybenzoic acid methyl ester;Einecs 225-728-8 | | CAS: | 5035-82-5 | | MF: | C11H15NO5 | | MW: | 241.24 | | EINECS: | 225-728-8 | | Product Categories: | Aromatic Esters;C10 to C11;Carbonyl Compounds;Esters | | Mol File: | 5035-82-5.mol |  |
| | Methyl 2-amino-3,4,5-trimethoxybenzoate Chemical Properties |
| Melting point | 44-45 °C(lit.) | | Boiling point | 127-140 °C0.1 mm Hg(lit.) | | density | 1.2611 (rough estimate) | | refractive index | 1.5080 (estimate) | | Fp | >230 °F | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 2.62±0.10(Predicted) | | form | Solid | | color | White to Pale Red | | InChI | 1S/C11H15NO5/c1-14-7-5-6(11(13)17-4)8(12)10(16-3)9(7)15-2/h5H,12H2,1-4H3 | | InChIKey | UPVUQELOASQBMY-UHFFFAOYSA-N | | SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1N | | CAS DataBase Reference | 5035-82-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Methyl 2-amino-3,4,5-trimethoxybenzoate Usage And Synthesis |
| Uses | Methyl 2-Amino-3,4,5-trimethoxybenzoate could be a constituent contributing to the aroma of green tea leaves. | | Uses | Methyl 3,4,5-trimethoxyanthranilate may be used in chemical synthesis. |
| | Methyl 2-amino-3,4,5-trimethoxybenzoate Preparation Products And Raw materials |
|