|
|
| | 3-Bromo-4-chlorobenzotrifluoride Basic information |
| Product Name: | 3-Bromo-4-chlorobenzotrifluoride | | Synonyms: | 3-beomo-4-chlorobenzotrifluoride;2-Bromo-1-chloro-4-(trifluoromethyl)benzene
3-Bromo-4-chloro-alpha,alpha,alpha-trifluorotoluene;3-Bromo-4-chloro-alpha,alpha,alpha-trifluorotoluene, 2-Bromo-1-chloro-4-(trifluoromethyl)benzene;3-bromo-4-chloro-trifluoromethylbenzene;3-Bromo-4-chloro-α,α,α-trifluorotoluene;Benzene, 2-bromo-1-chloro-4-(trifluoromethyl)-;Benzene,2-bromo-1-chloro-4-(trifluoromethyl)-;3-Bromo-4-Chlorobenzotrifuoride | | CAS: | 454-78-4 | | MF: | C7H3BrClF3 | | MW: | 259.45 | | EINECS: | 207-226-0 | | Product Categories: | Aromatic Halides (substituted);Trifluoromethyl-benzene series | | Mol File: | 454-78-4.mol |  |
| | 3-Bromo-4-chlorobenzotrifluoride Chemical Properties |
| Melting point | −23-−22 °C(lit.) | | Boiling point | 188-190 °C(lit.) | | density | 1.726 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.499(lit.) | | Fp | 202 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | Specific Gravity | 1.726 | | color | Clear very slightly yellow | | BRN | 1638470 | | InChI | InChI=1S/C7H3BrClF3/c8-5-3-4(7(10,11)12)1-2-6(5)9/h1-3H | | InChIKey | APSISOSWYXCEQX-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C1=CC=C(Cl)C(Br)=C1 | | CAS DataBase Reference | 454-78-4(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Bromo-4-chlorobenzotrifluoride(454-78-4) |
| | 3-Bromo-4-chlorobenzotrifluoride Usage And Synthesis |
| Chemical Properties | colorlesstolightyellowliqui | | Uses | 3-Bromo-4-chlorobenzotrifluoride serves as a starting material for synthesizing 2,2,6-tris(trifluoromethyl)-2H-chromene via palladium-catalyzed coupling with trimethylsilylacetylene followed by further reactions[1]. | | Synthesis Reference(s) | Journal of the American Chemical Society, 72, p. 1651, 1950 DOI: 10.1021/ja01160a063 | | References | [1]Sosnovskikh, V. Y., Usachev, B. I., Sevenard, D. V., & Röschenthaler, G.-V. (2005). Nucleophilic trifluoromethylation of RF-containing 4-quinolones, 8-aza- and 1-thiochromones with (trifluoromethyl)trimethylsilane. Journal of Fluorine Chemistry, 126(5), 779–784. https://doi.org/10.1016/j.jfluchem.2005.03.001
|
| | 3-Bromo-4-chlorobenzotrifluoride Preparation Products And Raw materials |
|