| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid Basic information |
| | 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid Chemical Properties |
| Melting point | 244-248 °C (dec.)(lit.) | | Boiling point | 459.0±55.0 °C(Predicted) | | density | 1.381±0.06 g/cm3(Predicted) | | solubility | DMF: 1.5 mg/ml; DMSO: 2 mg/ml; DMSO:PBS(pH7.2) (1:1): 0.5 mg/ml | | form | A crystalline solid | | pka | 1.71±0.37(Predicted) | | InChI | 1S/C10H8N2O2S/c1-6-8(10(13)14)15-9(12-6)7-3-2-4-11-5-7/h2-5H,1H3,(H,13,14) | | InChIKey | CJLQNROYBZEUGH-UHFFFAOYSA-N | | SMILES | Cc1nc(sc1C(O)=O)-c2cccnc2 | | CAS DataBase Reference | 39091-01-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934100090 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid Usage And Synthesis |
| Description | 2-(3-pyridyl)-4-methyl-Thiazole-5-carboxylic acid is a synthetic intermediate useful for pharmaceutical synthesis. | | Uses | 2-(3-Pyridyl)-4-methyl-thiazole-5-carboxylic acid is a synthetic intermediate useful for pharmaceutical synthesis. | | Synthesis | 1. Synthesis of ethyl 2-bromo-4-methylthiazole-5-carboxylate: Ethyl 2-amino-4-methylthiazole-5-carboxylate is diazotized and brominated (with CuBr).
2. Synthesis of target product: The bromo compound from step 1 undergoes Suzuki coupling with pyridine-3-boronic acid pinacol ester in the presence of Pd catalysts (XPhos-Pd-G2, XPhos). |
| | 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid Preparation Products And Raw materials |
|